Rivaroxaban metabolite M18
Modify Date: 2026-08-05 12:09:19
Rivaroxaban metabolite M18 structure
|
Common Name | Rivaroxaban metabolite M18 | ||
|---|---|---|---|---|
| CAS Number | 1160170-07-9 | Molecular Weight | 306.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Rivaroxaban metabolite M18 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14N2O6 |
|---|---|
| Molecular Weight | 306.27 |
| InChIKey | SRPDKSYHAUEWIX-LLVKDONJSA-N |
| SMILES | O=C(O)C1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Rivaroxaban metabolite M18? |
| A: SMILES notation of Rivaroxaban metabolite M18 is O=C(O)C1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1. |
| Q: What is the molecular formula of Rivaroxaban metabolite M18? |
| A: Molecular formula of Rivaroxaban metabolite M18 is C14H14N2O6. |
| Q: What is the Chinese name of 1160170-07-9? |
| A: Chinese name of 1160170-07-9 is 1160170-07-9. |
| Q: What is the InChIKey of Rivaroxaban metabolite M18? |
| A: InChIKey of Rivaroxaban metabolite M18 is SRPDKSYHAUEWIX-LLVKDONJSA-N. |
| Q: What is the English name of Rivaroxaban metabolite M18? |
| A: The English name of Rivaroxaban metabolite M18 is Rivaroxaban metabolite M18. |
| Q: What is the molecular weight of Rivaroxaban metabolite M18? |
| A: Molecular weight of Rivaroxaban metabolite M18 is 306.27. |
| Q: What is the CAS number of Rivaroxaban metabolite M18? |
| A: CAS number of Rivaroxaban metabolite M18 is 1160170-07-9. |