5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione
Modify Date: 2025-11-03 11:45:34
![5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione Structure](https://www.chemsrc.com/extcaspic/295/1160592-13-1.png)
5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione structure
|
Common Name | 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione | ||
|---|---|---|---|---|
| CAS Number | 1160592-13-1 | Molecular Weight | 207.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5NO5 |
|---|---|
| Molecular Weight | 207.14 |
| InChIKey | ICTZQAOLAIGOTC-UHFFFAOYSA-N |
| SMILES | NC(=O)Oc1ccc2c(c1)C(=O)OC2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione? |
| A: CAS number of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione is 1160592-13-1. |
| Q: What is the English name of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione? |
| A: The English name of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione is 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione. |
| Q: What is the InChIKey of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione? |
| A: InChIKey of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione is ICTZQAOLAIGOTC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione? |
| A: SMILES notation of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione is NC(=O)Oc1ccc2c(c1)C(=O)OC2=O. |
| Q: What is the molecular formula of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione? |
| A: Molecular formula of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione is C9H5NO5. |
| Q: What is the molecular weight of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione? |
| A: Molecular weight of 5-[(Aminocarbonyl)oxy]-1,3-isobenzofurandione is 207.14. |
| Q: What is the Chinese name of 1160592-13-1? |
| A: Chinese name of 1160592-13-1 is 1160592-13-1. |