2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine structure
|
Common Name | 2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine | ||
|---|---|---|---|---|
| CAS Number | 1160995-45-8 | Molecular Weight | 233.012 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H2Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Molecular Formula | C6H2Cl2N4O2 |
| Molecular Weight | 233.012 |
| Exact Mass | 231.955475 |
| PSA | 76.01000 |
| LogP | 1.93 |
| Index of Refraction | 1.806 |
| InChIKey | UILXDKCIJUPNOF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2c(Cl)nc(Cl)nn2c1 |
|
~37%
2,4-Dichloro-6-... CAS#:1160995-45-8 |
| Literature: Abraham, Sunny; Hadd, Michael J.; Tran, Lan; Vickers, Troy; Sindac, Janice; Milanov, Zdravko V.; Holladay, Mark W.; Bhagwat, Shripad S.; Hua, Helen; Ford Pulido, Julia M.; Cramer, Merryl D.; Gitnick, Dana; James, Joyce; Dao, Alan; Belli, Barbara; Armstrong, Robert C.; Treiber, Daniel K.; Liu, Gang Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 18 p. 5296 - 5300 |
|
~%
2,4-Dichloro-6-... CAS#:1160995-45-8 |
| Literature: AMBIT BIOSCIENCES CORPORATION; ABRAHAM, Sunny; BHAGWAT, Shripad, S.; HADD, Michael, J.; HOLLADAY, Mark, W.; LIU, Gang; MILANOV, Zdravko, V.; PATEL, Hitesh, K.; SETTI, Eduardo; SINDAC, Janice, A. Patent: WO2011/88045 A1, 2011 ; WO 2011/088045 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| SC3031 |
| X9155 |
| 2,4-Dichloro-6-nitropyrrolo[2,1-f][1,2,4]triazine |
| 2,4-Dichloro-6-(nitro)pyrrolo[2,1-f][1,2,4]triazine |
| Pyrrolo[2,1-f][1,2,4]triazine, 2,4-dichloro-6-nitro- |