Methyl 2-Boc-2-aza-bicyclo-[2.1.1]hexane-1-carboxylate
![Methyl 2-Boc-2-aza-bicyclo-[2.1.1]hexane-1-carboxylate Structure](https://image.chemsrc.com/caspic/121/116129-01-2.png)
Methyl 2-Boc-2-aza-bicyclo-[2.1.1]hexane-1-carboxylate structure
|
Common Name | Methyl 2-Boc-2-aza-bicyclo-[2.1.1]hexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 116129-01-2 | Molecular Weight | 241.284 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 298.6±23.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.4±22.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 298.6±23.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.284 |
| Flash Point | 134.4±22.6 °C |
| Exact Mass | 241.131409 |
| PSA | 55.84000 |
| LogP | 0.86 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | VZVOIULUBSWICB-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(CN1C(=O)OC(C)(C)C)C2 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
![2-Azabicyclo[2.1.1]hexane-1-carboxylicacid,3-oxo-,methylester(9CI) structure](https://image.chemsrc.com/caspic/469/116129-05-6.png)
CAS#:116129-05-6
CAS#:116129-04-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Methyl 2-(2-methyl-2-propanyl) 2-azabicyclo[2.1.1]hexane-1,2-dicarboxylate |
| .methyl N-(tert-butyloxycarbonyl)-2,4-methanoproline |
| N-tert-butoxycarbonyl-2,4-methanoproline methyl ester |
| 2-Azabicyclo[2.1.1]hexane-1,2-dicarboxylic acid, 2-(1,1-dimethylethyl) 1-methyl ester |
| Methyl 2-Boc-2-aza-bicyclo-[2.1.1]hexane-1-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: CAS number of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane is 116129-01-2. |
| Q: What English synonyms does N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane have? |
| A: English synonyms of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane: 1-Methyl 2-(2-methyl-2-propanyl) 2-azabicyclo[2.1.1]hexane-1,2-dicarboxylate, .methyl N-(tert-butyloxycarbonyl)-2,4-methanoproline, N-tert-butoxycarbonyl-2,4-methanoproline methyl ester, 2-Azabicyclo[2.1.1]hexane-1,2-dicarboxylic acid, 2-(1,1-dimethylethyl) 1-methyl ester, Methyl 2-Boc-2-aza-bicyclo-[2.1.1]hexane-1-carboxylate. |
| Q: What is the SMILES notation of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: SMILES notation of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane is COC(=O)C12CC(CN1C(=O)OC(C)(C)C)C2. |
| Q: What is the molecular weight of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: Molecular weight of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane is 241.284. |
| Q: What is the Chinese name of 116129-01-2? |
| A: Chinese name of 116129-01-2 is 116129-01-2. |
| Q: What is the boiling point of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: Boiling point of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane is 298.6±23.0 °C at 760 mmHg. |
| Q: What is the English name of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: The English name of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane is N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane. |
| Q: What is the InChIKey of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: InChIKey of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane is VZVOIULUBSWICB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: Molecular formula of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane is C12H19NO4. |
| Q: What are the downstream products of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane? |
| A: Related downstream products(CAS) of N-(t-butoxycarbonyl)-1-carbomethoxy-2-azabicyclo[2.1.1]hexane: 116129-05-6;116129-04-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |