4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile
4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile structure
|
Common Name | 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 116156-22-0 | Molecular Weight | 261.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H11NO2 |
|---|---|
| Molecular Weight | 261.27500 |
| Exact Mass | 261.07900 |
| PSA | 50.09000 |
| LogP | 3.02588 |
| InChIKey | XMVKHOBESLJQLW-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(5-oxo-4-phen... CAS#:116156-22-0 |
| Literature: Fuji, Koji; Morimoto, Tsumoru; Tsutsumi, Ken; Kakiuchi, Kiyomi Chemical Communications, 2005 , # 26 p. 3295 - 3297 |
|
~%
4-(5-oxo-4-phen... CAS#:116156-22-0 |
| Literature: Navidpour, Latifeh; Amini, Mohsen; Shafaroodi, Hamed; Abdi, Khosrou; Ghahremani, Mohammad H.; Dehpour, Ahmad Reza; Shafiee, Abbas Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 17 p. 4483 - 4487 |
|
~%
4-(5-oxo-4-phen... CAS#:116156-22-0 |
| Literature: Navidpour, Latifeh; Amini, Mohsen; Shafaroodi, Hamed; Abdi, Khosrou; Ghahremani, Mohammad H.; Dehpour, Ahmad Reza; Shafiee, Abbas Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 17 p. 4483 - 4487 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: Molecular weight of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is 261.27500. |
| Q: What is the CAS number of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: CAS number of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is 116156-22-0. |
| Q: What is the polar surface area (PSA) of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: Polar surface area (PSA) of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is 50.09000. |
| Q: What is the English name of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: The English name of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile. |
| Q: What is the LogP of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: LogP of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is 3.02588. |
| Q: What is the Chinese name of 116156-22-0? |
| A: Chinese name of 116156-22-0 is 116156-22-0. |
| Q: What are the upstream materials of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: Related upstream materials(CAS) of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile: 536-74-3;103-82-2;20099-89-2. |
| Q: What is the molecular formula of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: Molecular formula of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is C17H11NO2. |
| Q: What is the InChIKey of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: InChIKey of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is XMVKHOBESLJQLW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile? |
| A: SMILES notation of 4-(5-oxo-4-phenyl-2H-furan-3-yl)benzonitrile is N#Cc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1. |