triethyl(naphthalen-1-yl)stannane
triethyl(naphthalen-1-yl)stannane structure
|
Common Name | triethyl(naphthalen-1-yl)stannane | ||
|---|---|---|---|---|
| CAS Number | 116159-67-2 | Molecular Weight | 333.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | triethyl(naphthalen-1-yl)stannane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H22Sn |
|---|---|
| Molecular Weight | 333.04700 |
| Exact Mass | 334.07400 |
| LogP | 4.78040 |
| InChIKey | IKQDHURUHIJUBM-UHFFFAOYSA-N |
| SMILES | CC[Sn](CC)(CC)c1cccc2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~61%
triethyl(naphth... CAS#:116159-67-2 |
| Literature: Mochida, Kunio Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 9 p. 3299 - 3306 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 4 | |
CAS#:91-20-3
CAS#:661-69-8
CAS#:2935-54-8
CAS#:944-85-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of triethyl(naphthalen-1-yl)stannane? |
| A: InChIKey of triethyl(naphthalen-1-yl)stannane is IKQDHURUHIJUBM-UHFFFAOYSA-N. |
| Q: What is the English name of triethyl(naphthalen-1-yl)stannane? |
| A: The English name of triethyl(naphthalen-1-yl)stannane is triethyl(naphthalen-1-yl)stannane. |
| Q: What is the molecular weight of triethyl(naphthalen-1-yl)stannane? |
| A: Molecular weight of triethyl(naphthalen-1-yl)stannane is 333.04700. |
| Q: What are the downstream products of triethyl(naphthalen-1-yl)stannane? |
| A: Related downstream products(CAS) of triethyl(naphthalen-1-yl)stannane: 91-20-3;661-69-8;2935-54-8;944-85-4. |
| Q: What are the upstream materials of triethyl(naphthalen-1-yl)stannane? |
| A: Related upstream materials(CAS) of triethyl(naphthalen-1-yl)stannane: 90-11-9;994-31-0. |
| Q: What is the SMILES notation of triethyl(naphthalen-1-yl)stannane? |
| A: SMILES notation of triethyl(naphthalen-1-yl)stannane is CC[Sn](CC)(CC)c1cccc2ccccc12. |
| Q: What is the LogP of triethyl(naphthalen-1-yl)stannane? |
| A: LogP of triethyl(naphthalen-1-yl)stannane is 4.78040. |
| Q: What is the Chinese name of 116159-67-2? |
| A: Chinese name of 116159-67-2 is 116159-67-2. |
| Q: What is the molecular formula of triethyl(naphthalen-1-yl)stannane? |
| A: Molecular formula of triethyl(naphthalen-1-yl)stannane is C16H22Sn. |
| Q: What is the CAS number of triethyl(naphthalen-1-yl)stannane? |
| A: CAS number of triethyl(naphthalen-1-yl)stannane is 116159-67-2. |