triethyl(naphthalen-1-yl)stannane structure
|
Common Name | triethyl(naphthalen-1-yl)stannane | ||
|---|---|---|---|---|
| CAS Number | 116159-67-2 | Molecular Weight | 333.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triethyl(naphthalen-1-yl)stannane |
|---|
| Molecular Formula | C16H22Sn |
|---|---|
| Molecular Weight | 333.04700 |
| Exact Mass | 334.07400 |
| LogP | 4.78040 |
| InChIKey | IKQDHURUHIJUBM-UHFFFAOYSA-N |
| SMILES | CC[Sn](CC)(CC)c1cccc2ccccc12 |
|
~61%
triethyl(naphth... CAS#:116159-67-2 |
| Literature: Mochida, Kunio Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 9 p. 3299 - 3306 |