ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate
![ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate Structure](https://image.chemsrc.com/caspic/083/116221-81-9.png)
ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate structure
|
Common Name | ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 116221-81-9 | Molecular Weight | 267.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate (Chinese name: 乙基N-[5-(4-氯苯基)-1,3,4-氧二唑-2-基] carbamate, CAS number: 116221-81-9, molecular formula: C11H10ClN3O3, molecular weight: 267.66800), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10ClN3O3 |
|---|---|
| Molecular Weight | 267.66800 |
| Exact Mass | 267.04100 |
| PSA | 80.48000 |
| LogP | 2.38030 |
| InChIKey | MQXDFYOKYMRWBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1nnc(-c2ccc(Cl)cc2)o1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl N-[5-(4-c... CAS#:116221-81-9 |
| Literature: Mishra, Atma R.; Singh, Shailendra; Wahab, Abdul Journal of Agricultural and Food Chemistry, 2000 , vol. 48, # 11 p. 5465 - 5468 |
![[(4-chlorophenyl)methylideneamino]urea structure](https://image.chemsrc.com/caspic/338/5315-86-6.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: The English name of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate. |
| Q: What is the InChIKey of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: InChIKey of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is MQXDFYOKYMRWBI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 116221-81-9? |
| A: Chinese name of 116221-81-9 is 116221-81-9. |
| Q: What is the SMILES notation of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: SMILES notation of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is CCOC(=O)Nc1nnc(-c2ccc(Cl)cc2)o1. |
| Q: What is the molecular formula of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: Molecular formula of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is C11H10ClN3O3. |
| Q: What is the molecular weight of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: Molecular weight of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is 267.66800. |
| Q: What is the LogP of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: LogP of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is 2.38030. |
| Q: What is the polar surface area (PSA) of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: Polar surface area (PSA) of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is 80.48000. |
| Q: What are the upstream materials of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: Related upstream materials(CAS) of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate: 5315-86-6. |
| Q: What is the CAS number of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate? |
| A: CAS number of ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate is 116221-81-9. |