ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate structure
|
Common Name | ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 116221-81-9 | Molecular Weight | 267.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]carbamate |
|---|
| Molecular Formula | C11H10ClN3O3 |
|---|---|
| Molecular Weight | 267.66800 |
| Exact Mass | 267.04100 |
| PSA | 80.48000 |
| LogP | 2.38030 |
| InChIKey | MQXDFYOKYMRWBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1nnc(-c2ccc(Cl)cc2)o1 |
|
~%
ethyl N-[5-(4-c... CAS#:116221-81-9 |
| Literature: Mishra, Atma R.; Singh, Shailendra; Wahab, Abdul Journal of Agricultural and Food Chemistry, 2000 , vol. 48, # 11 p. 5465 - 5468 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |