1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one
1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one structure
|
Common Name | 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 116227-86-2 | Molecular Weight | 291.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one, Chinese name is 1-苯基-3-(2-苯基-1,3-噻唑-4-基)丙-2-烯-1-酮, CAS number is 116227-86-2, molecular formula is C18H13NOS, molecular weight is 291.36700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H13NOS |
|---|---|
| Molecular Weight | 291.36700 |
| Exact Mass | 291.07200 |
| PSA | 58.20000 |
| LogP | 4.70620 |
| InChIKey | LEDCZKLWQJHQPE-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1csc(-c2ccccc2)n1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-phenyl-3-(2-p... CAS#:116227-86-2 |
| Literature: Simiti, I.; Zaharia, V.; Coman, M.; Demian, H.; Muresan, A. Pharmazie, 1988 , vol. 43, # 2 p. 82 - 84 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: The English name of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one. |
| Q: What is the InChIKey of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: InChIKey of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is LEDCZKLWQJHQPE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: Molecular formula of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is C18H13NOS. |
| Q: What are the upstream materials of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: Related upstream materials(CAS) of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one: 20949-81-9;98-86-2. |
| Q: What is the molecular weight of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: Molecular weight of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is 291.36700. |
| Q: What is the SMILES notation of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: SMILES notation of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is O=C(C=Cc1csc(-c2ccccc2)n1)c1ccccc1. |
| Q: What is the Chinese name of 116227-86-2? |
| A: Chinese name of 116227-86-2 is 116227-86-2. |
| Q: What is the LogP of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: LogP of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is 4.70620. |
| Q: What is the CAS number of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: CAS number of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is 116227-86-2. |
| Q: What is the polar surface area (PSA) of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one? |
| A: Polar surface area (PSA) of 1-phenyl-3-(2-phenyl-1,3-thiazol-4-yl)prop-2-en-1-one is 58.20000. |