Sodium Tosylate-d7
Modify Date: 2026-09-27 16:50:48
Sodium Tosylate-d7 structure
|
Common Name | Sodium Tosylate-d7 | ||
|---|---|---|---|---|
| CAS Number | 116237-84-4 | Molecular Weight | 201.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7NaO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium Tosylate-d7 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7NaO3S |
|---|---|
| Molecular Weight | 201.23 |
| InChIKey | KVCGISUBCHHTDD-ANHTTWOXSA-M |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Sodium Tosylate-d7? |
| A: InChIKey of Sodium Tosylate-d7 is KVCGISUBCHHTDD-ANHTTWOXSA-M. |
| Q: What is the SMILES notation of Sodium Tosylate-d7? |
| A: SMILES notation of Sodium Tosylate-d7 is Cc1ccc(S(=O)(=O)[O-])cc1.[Na+]. |
| Q: What is the Chinese name of 116237-84-4? |
| A: Chinese name of 116237-84-4 is 116237-84-4. |
| Q: What is the CAS number of Sodium Tosylate-d7? |
| A: CAS number of Sodium Tosylate-d7 is 116237-84-4. |
| Q: What is the English name of Sodium Tosylate-d7? |
| A: The English name of Sodium Tosylate-d7 is Sodium Tosylate-d7. |
| Q: What is the molecular formula of Sodium Tosylate-d7? |
| A: Molecular formula of Sodium Tosylate-d7 is C7H7NaO3S. |
| Q: What is the molecular weight of Sodium Tosylate-d7? |
| A: Molecular weight of Sodium Tosylate-d7 is 201.23. |