1-(2-nitrophenyl)ethylidenehydrazine
1-(2-nitrophenyl)ethylidenehydrazine structure
|
Common Name | 1-(2-nitrophenyl)ethylidenehydrazine | ||
|---|---|---|---|---|
| CAS Number | 116271-34-2 | Molecular Weight | 179.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: The Chinese name of 1-(2-nitrophenyl)ethylidenehydrazine is 1-(2-硝基苯基)乙基亚肼，with the English name 1-(2-nitrophenyl)ethylidenehydrazine and CAS number 116271-34-2. The molecular formula is C8H9N3O2 and the molecular weight is 179.17600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-nitrophenyl)ethylidenehydrazine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9N3O2 |
|---|---|
| Molecular Weight | 179.17600 |
| Exact Mass | 179.06900 |
| PSA | 84.20000 |
| LogP | 2.50100 |
| InChIKey | QJWDISQVXGQOQQ-UHFFFAOYSA-N |
| SMILES | CC(=NN)c1ccccc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
1-(2-nitropheny... CAS#:116271-34-2 |
| Literature: Sainlos, Matthieu; Iskenderian-Epps, Wendy S.; Olivier, Nelson B.; Choquet, Daniel; Imperiali, Barbara Journal of the American Chemical Society, 2013 , vol. 135, # 12 p. 4580 - 4583 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:114119-94-7
CAS#:25798-61-2
CAS#:67030-27-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2'-nitroacetophenone hydrazone |
| hydrazone of 2-nitroacetophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: Molecular weight of 1-(2-nitrophenyl)ethylidenehydrazine is 179.17600. |
| Q: What is the molecular formula of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: Molecular formula of 1-(2-nitrophenyl)ethylidenehydrazine is C8H9N3O2. |
| Q: What English synonyms does 1-(2-nitrophenyl)ethylidenehydrazine have? |
| A: English synonyms of 1-(2-nitrophenyl)ethylidenehydrazine: 2'-nitroacetophenone hydrazone, hydrazone of 2-nitroacetophenone. |
| Q: What is the LogP of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: LogP of 1-(2-nitrophenyl)ethylidenehydrazine is 2.50100. |
| Q: What is the InChIKey of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: InChIKey of 1-(2-nitrophenyl)ethylidenehydrazine is QJWDISQVXGQOQQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: SMILES notation of 1-(2-nitrophenyl)ethylidenehydrazine is CC(=NN)c1ccccc1[N+](=O)[O-]. |
| Q: What is the CAS number of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: CAS number of 1-(2-nitrophenyl)ethylidenehydrazine is 116271-34-2. |
| Q: What is the English name of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: The English name of 1-(2-nitrophenyl)ethylidenehydrazine is 1-(2-nitrophenyl)ethylidenehydrazine. |
| Q: What are the upstream materials of 1-(2-nitrophenyl)ethylidenehydrazine? |
| A: Related upstream materials(CAS) of 1-(2-nitrophenyl)ethylidenehydrazine: 577-59-3. |
| Q: What is the Chinese name of 116271-34-2? |
| A: Chinese name of 116271-34-2 is 116271-34-2. |