5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
![5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate Structure](https://image.chemsrc.com/caspic/415/116308-47-5.png)
5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate structure
|
Common Name | 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 116308-47-5 | Molecular Weight | 612.71700 | |
| Density | 1.26g/cm3 | Boiling Point | 784.6ºC at 760 mmHg | |
| Molecular Formula | C38H36N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 428.3ºC | |
Summary: 5-O-[2-[4-(dibenzylamino)phenyl]ethyl]-3-O-methyl-4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, CAS 116308-47-5, molecular formula C38H36N4O4, molecular weight 612.71700, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 784.6ºC at 760 mmHg |
| Molecular Formula | C38H36N4O4 |
| Molecular Weight | 612.71700 |
| Flash Point | 428.3ºC |
| Exact Mass | 612.27400 |
| PSA | 104.55000 |
| LogP | 6.68258 |
| Vapour Pressure | 1.4E-24mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | GJEAGEJISKLAIS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCc2ccc(N(Cc3ccccc3)Cc3ccccc3)cc2)C1c1cc(C#N)ccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~39%
5-O-[2-[4-(dibe... CAS#:116308-47-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 39, # 1 p. 91 - 99 |
|
~%
5-O-[2-[4-(dibe... CAS#:116308-47-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 39, # 1 p. 91 - 99 |
|
~%
5-O-[2-[4-(dibe... CAS#:116308-47-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 39, # 1 p. 91 - 99 |
|
~%
5-O-[2-[4-(dibe... CAS#:116308-47-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 39, # 1 p. 91 - 99 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: LogP of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 6.68258. |
| Q: What are the upstream materials of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Related upstream materials(CAS) of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate: 116308-38-4;116308-37-3;21731-17-9;100-39-0;116308-36-2;104-10-9. |
| Q: What is the CAS number of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: CAS number of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 116308-47-5. |
| Q: What is the polar surface area (PSA) of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Polar surface area (PSA) of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 104.55000. |
| Q: What is the molecular formula of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Molecular formula of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is C38H36N4O4. |
| Q: What is the boiling point of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Boiling point of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 784.6ºC at 760 mmHg. |
| Q: What is the Chinese name of 116308-47-5? |
| A: Chinese name of 116308-47-5 is 116308-47-5. |
| Q: What is the SMILES notation of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: SMILES notation of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is COC(=O)C1=C(C)NC(C)=C(C(=O)OCCc2ccc(N(Cc3ccccc3)Cc3ccccc3)cc2)C1c1cc(C#N)ccn1. |
| Q: What is the English name of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: The English name of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. |
| Q: What is the molecular weight of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate? |
| A: Molecular weight of 5-O-[2-[4-(dibenzylamino)phenyl]ethyl] 3-O-methyl 4-(4-cyanopyridin-2-yl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate is 612.71700. |