carbocyclic Nebularine
Modify Date: 2026-04-18 00:45:27
carbocyclic Nebularine structure
|
Common Name | carbocyclic Nebularine | ||
|---|---|---|---|---|
| CAS Number | 116331-52-3 | Molecular Weight | 250.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | carbocyclic Nebularine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14N4O3 |
|---|---|
| Molecular Weight | 250.25 |
| InChIKey | DYWKILDUIMVCND-QQRDMOCMSA-N |
| SMILES | C1[C@@H]([C@H]([C@H]([C@@H]1N2C=NC3=CN=CN=C32)O)O)CO |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of carbocyclic Nebularine? |
| A: SMILES notation of carbocyclic Nebularine is C1[C@@H]([C@H]([C@H]([C@@H]1N2C=NC3=CN=CN=C32)O)O)CO. |
| Q: What is the Chinese name of 116331-52-3? |
| A: Chinese name of 116331-52-3 is 116331-52-3. |
| Q: What is the InChIKey of carbocyclic Nebularine? |
| A: InChIKey of carbocyclic Nebularine is DYWKILDUIMVCND-QQRDMOCMSA-N. |
| Q: What is the molecular weight of carbocyclic Nebularine? |
| A: Molecular weight of carbocyclic Nebularine is 250.25. |
| Q: What is the molecular formula of carbocyclic Nebularine? |
| A: Molecular formula of carbocyclic Nebularine is C11H14N4O3. |
| Q: What is the English name of carbocyclic Nebularine? |
| A: The English name of carbocyclic Nebularine is carbocyclic Nebularine. |
| Q: What is the CAS number of carbocyclic Nebularine? |
| A: CAS number of carbocyclic Nebularine is 116331-52-3. |