7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one structure
|
Common Name | 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 116337-60-1 | Molecular Weight | 281.30600 | |
| Density | 1.19g/cm3 | Boiling Point | 483.2ºC at 760mmHg | |
| Molecular Formula | C17H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246ºC | |
Summary: 7-Benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS: 116337-60-1, molecular formula: C17H15NO3, molecular weight: 281.30600), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 483.2ºC at 760mmHg |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.30600 |
| Flash Point | 246ºC |
| Exact Mass | 281.10500 |
| PSA | 58.89000 |
| LogP | 3.11220 |
| Vapour Pressure | 1.72E-09mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | NLLZZPGHXJYMGH-UHFFFAOYSA-N |
| SMILES | CC1(C)Oc2cc(C(=O)c3ccccc3)ccc2NC1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~68%
7-benzoyl-2,2-d... CAS#:116337-60-1 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
|
~%
7-benzoyl-2,2-d... CAS#:116337-60-1 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: LogP of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is 3.11220. |
| Q: What is the English name of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: The English name of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one. |
| Q: What is the polar surface area (PSA) of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: Polar surface area (PSA) of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is 58.89000. |
| Q: What are the upstream materials of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: Related upstream materials(CAS) of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one: 600-00-0;31684-63-6;54903-12-7. |
| Q: What is the molecular formula of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: Molecular formula of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is C17H15NO3. |
| Q: What is the InChIKey of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: InChIKey of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is NLLZZPGHXJYMGH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: SMILES notation of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is CC1(C)Oc2cc(C(=O)c3ccccc3)ccc2NC1=O. |
| Q: What is the CAS number of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: CAS number of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is 116337-60-1. |
| Q: What is the molecular weight of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: Molecular weight of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is 281.30600. |
| Q: What is the boiling point of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one? |
| A: Boiling point of 7-benzoyl-2,2-dimethyl-4H-1,4-benzoxazin-3-one is 483.2ºC at 760mmHg. |