7-benzoyl-4-methyl-1,4-benzoxazin-3-one
7-benzoyl-4-methyl-1,4-benzoxazin-3-one structure
|
Common Name | 7-benzoyl-4-methyl-1,4-benzoxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 116337-61-2 | Molecular Weight | 267.27900 | |
| Density | 1.254g/cm3 | Boiling Point | 540.3ºC at 760 mmHg | |
| Molecular Formula | C16H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.5ºC | |
Summary: 7-Benzoyl-4-methyl-1,4-benzoxazin-3-one (CAS: 116337-61-2), molecular formula C16H13NO3, molecular weight 267.27900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-benzoyl-4-methyl-1,4-benzoxazin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 540.3ºC at 760 mmHg |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.27900 |
| Flash Point | 280.5ºC |
| Exact Mass | 267.09000 |
| PSA | 46.61000 |
| LogP | 2.33780 |
| Vapour Pressure | 9.71E-12mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | HTYIAUSIYYSNMN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COc2cc(C(=O)c3ccccc3)ccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
7-benzoyl-4-met... CAS#:116337-61-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 55 - 60 |
|
~%
7-benzoyl-4-met... CAS#:116337-61-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 55 - 60 |
|
~%
7-benzoyl-4-met... CAS#:116337-61-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 55 - 60 |
|
~%
7-benzoyl-4-met... CAS#:116337-61-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 55 - 60 |
![[3-hydroxy-4-(methylamino)phenyl]-phenylmethanone structure](https://image.chemsrc.com/caspic/069/54903-59-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 116337-61-2? |
| A: Chinese name of 116337-61-2 is 116337-61-2. |
| Q: What is the molecular formula of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Molecular formula of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is C16H13NO3. |
| Q: What is the LogP of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: LogP of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is 2.33780. |
| Q: What is the InChIKey of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: InChIKey of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is HTYIAUSIYYSNMN-UHFFFAOYSA-N. |
| Q: What is the boiling point of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Boiling point of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is 540.3ºC at 760 mmHg. |
| Q: What are the upstream materials of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Related upstream materials(CAS) of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one: 54903-59-2;105-36-2;21892-80-8;65-85-0;54903-63-8. |
| Q: What is the English name of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: The English name of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is 7-benzoyl-4-methyl-1,4-benzoxazin-3-one. |
| Q: What is the SMILES notation of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: SMILES notation of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is CN1C(=O)COc2cc(C(=O)c3ccccc3)ccc21. |
| Q: What is the molecular weight of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Molecular weight of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is 267.27900. |
| Q: What is the CAS number of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one? |
| A: CAS number of 7-benzoyl-4-methyl-1,4-benzoxazin-3-one is 116337-61-2. |