7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one structure
|
Common Name | 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 116337-63-4 | Molecular Weight | 287.69800 | |
| Density | 1.37g/cm3 | Boiling Point | 527.7ºC at 760 mmHg | |
| Molecular Formula | C15H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.9ºC | |
Summary: 7-(4-Chlorobenzoyl)-4H-1,4-benzoxazin-3-one (CAS: 116337-63-4), molecular formula C15H10ClNO3, molecular weight 287.69800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 527.7ºC at 760 mmHg |
| Molecular Formula | C15H10ClNO3 |
| Molecular Weight | 287.69800 |
| Flash Point | 272.9ºC |
| Exact Mass | 287.03500 |
| PSA | 58.89000 |
| LogP | 2.98700 |
| Vapour Pressure | 3.18E-11mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | BBUISRBREJZENZ-UHFFFAOYSA-N |
| SMILES | O=C1COc2cc(C(=O)c3ccc(Cl)cc3)ccc2N1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~50%
7-(4-chlorobenz... CAS#:116337-63-4 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
|
~%
7-(4-chlorobenz... CAS#:116337-63-4 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
|
~%
7-(4-chlorobenz... CAS#:116337-63-4 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
|
~%
7-(4-chlorobenz... CAS#:116337-63-4 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: Boiling point of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is 527.7ºC at 760 mmHg. |
| Q: What is the molecular weight of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: Molecular weight of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is 287.69800. |
| Q: What is the InChIKey of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: InChIKey of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is BBUISRBREJZENZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: CAS number of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is 116337-63-4. |
| Q: What is the English name of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: The English name of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one. |
| Q: What is the Chinese name of 116337-63-4? |
| A: Chinese name of 116337-63-4 is 116337-63-4. |
| Q: What are the upstream materials of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: Related upstream materials(CAS) of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one: 105-36-2;123172-45-2;59-49-4;76751-94-5;74-11-3. |
| Q: What is the SMILES notation of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: SMILES notation of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is O=C1COc2cc(C(=O)c3ccc(Cl)cc3)ccc2N1. |
| Q: What is the molecular formula of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: Molecular formula of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is C15H10ClNO3. |
| Q: What is the LogP of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one? |
| A: LogP of 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one is 2.98700. |