7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one
7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one structure
|
Common Name | 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 116337-75-8 | Molecular Weight | 261.31600 | |
| Density | 1.098g/cm3 | Boiling Point | 475ºC at 760mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.1ºC | |
Summary: 7-Butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one (CAS号：116337-75-8，molecular formula：C15H19NO3，molecular weight：261.31600)，For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 475ºC at 760mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 241.1ºC |
| Exact Mass | 261.13600 |
| PSA | 46.61000 |
| LogP | 2.86820 |
| Vapour Pressure | 3.45E-09mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | ULIINUOUHATVLQ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1ccc2c(c1)OC(C)(C)C(=O)N2C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
7-butanoyl-2,2,... CAS#:116337-75-8 |
| Literature: Farmaco, , vol. 46, # 2 p. 339 - 355 |
|
~75%
7-butanoyl-2,2,... CAS#:116337-75-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 55 - 60 |
|
~%
7-butanoyl-2,2,... CAS#:116337-75-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 55 - 60 |
|
~%
7-butanoyl-2,2,... CAS#:116337-75-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 55 - 60 |
![1-[3-hydroxy-4-(methylamino)phenyl]butan-1-one structure](https://image.chemsrc.com/caspic/155/123172-48-5.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 1 | |
CAS#:116337-83-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: The English name of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one. |
| Q: What is the molecular formula of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: Molecular formula of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is C15H19NO3. |
| Q: What are the downstream products of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: Related downstream products(CAS) of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one: 116337-83-8. |
| Q: What is the InChIKey of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: InChIKey of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is ULIINUOUHATVLQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: Molecular weight of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is 261.31600. |
| Q: What is the polar surface area (PSA) of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: Polar surface area (PSA) of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is 46.61000. |
| Q: What is the SMILES notation of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: SMILES notation of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is CCCC(=O)c1ccc2c(c1)OC(C)(C)C(=O)N2C. |
| Q: What is the LogP of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: LogP of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is 2.86820. |
| Q: What is the Chinese name of 116337-75-8? |
| A: Chinese name of 116337-75-8 is 116337-75-8. |
| Q: What is the boiling point of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one? |
| A: Boiling point of 7-butanoyl-2,2,4-trimethyl-1,4-benzoxazin-3-one is 475ºC at 760mmHg. |