5-ethyl-1-phenylpyrazole-4-carboxylic acid structure
|
Common Name | 5-ethyl-1-phenylpyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 116344-16-2 | Molecular Weight | 216.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 5-ethyl-1-phenylpyrazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O2 |
|---|---|
| Molecular Weight | 216.23600 |
| Exact Mass | 216.09000 |
| PSA | 55.12000 |
| LogP | 2.13290 |
| InChIKey | VFLMYSWXEOLIOB-UHFFFAOYSA-N |
| SMILES | CCc1c(C(=O)O)cnn1-c1ccccc1 |
|
~86%
5-ethyl-1-pheny... CAS#:116344-16-2 |
| Literature: Menozzi; Mosti; Schenone Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 6 p. 1669 - 1675 |
|
~%
5-ethyl-1-pheny... CAS#:116344-16-2 |
| Literature: Menozzi; Mosti; Schenone Journal of Heterocyclic Chemistry, 1987 , vol. 24, # 6 p. 1669 - 1675 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-ethyl-1-phenyl-1H-pyrazole-4-carboxylic acid |
| 1H-Pyrazole-4-carboxylic acid,5-ethyl-1-phenyl |