N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester
Modify Date: 2025-10-10 19:07:46
![N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester Structure](https://www.chemsrc.com/extcaspic/277/116366-28-0.png)
N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester structure
|
Common Name | N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 116366-28-0 | Molecular Weight | 366.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H26N2O6 |
|---|---|
| Molecular Weight | 366.4 |
| InChIKey | JOMDTFQYLQIOMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1[N+](=O)[O-])C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester? |
| A: Molecular weight of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester is 366.4. |
| Q: What is the molecular formula of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester? |
| A: Molecular formula of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester is C18H26N2O6. |
| Q: What is the SMILES notation of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester? |
| A: SMILES notation of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester is CC(C)(C)OC(=O)NC(Cc1ccccc1[N+](=O)[O-])C(=O)OC(C)(C)C. |
| Q: What is the CAS number of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester? |
| A: CAS number of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester is 116366-28-0. |
| Q: What is the Chinese name of 116366-28-0? |
| A: Chinese name of 116366-28-0 is 116366-28-0. |
| Q: What is the InChIKey of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester? |
| A: InChIKey of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester is JOMDTFQYLQIOMO-UHFFFAOYSA-N. |
| Q: What is the English name of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester? |
| A: The English name of N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester is N-[(1,1-Dimethylethoxy)carbonyl]-2-nitrophenylalanine 1,1-dimethylethyl ester. |