3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl
Modify Date: 2025-11-04 16:55:31
![3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl Structure](https://www.chemsrc.com/extcaspic/086/116367-95-4.png)
3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl structure
|
Common Name | 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 116367-95-4 | Molecular Weight | 382.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H30N2O3 |
|---|---|
| Molecular Weight | 382.5 |
| InChIKey | ZCEFYENVNCGDMZ-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C(=O)O)c(C)nc(C)c1C(=O)Nc1c(CC)cccc1CC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl? |
| A: InChIKey of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl is ZCEFYENVNCGDMZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl? |
| A: Molecular weight of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl is 382.5. |
| Q: What is the molecular formula of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl? |
| A: Molecular formula of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl is C23H30N2O3. |
| Q: What is the English name of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl? |
| A: The English name of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl is 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl. |
| Q: What is the Chinese name of 116367-95-4? |
| A: Chinese name of 116367-95-4 is 116367-95-4. |
| Q: What is the SMILES notation of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl? |
| A: SMILES notation of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl is CCCCc1c(C(=O)O)c(C)nc(C)c1C(=O)Nc1c(CC)cccc1CC. |
| Q: What is the CAS number of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl? |
| A: CAS number of 3-Pyridinecarboxylic acid,4-butyl-5-[[(2,6-diethylphenyl)amino]carbonyl]-2,6-dimethyl is 116367-95-4. |