N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine
N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine structure
|
Common Name | N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 116374-65-3 | Molecular Weight | 358.82200 | |
| Density | 1.341g/cm3 | Boiling Point | 544.3ºC at 760 mmHg | |
| Molecular Formula | C18H19ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283ºC | |
Summary: N-(4-Chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine, Chinese name: N-(4-氯-1-硝基咔唑-9-基)-N',N'-二甲基丙烷-1,3-二胺, CAS number: 116374-65-3, molecular formula: C18H19ClN4O2, molecular weight: 358.82200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 544.3ºC at 760 mmHg |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.82200 |
| Flash Point | 283ºC |
| Exact Mass | 358.12000 |
| PSA | 77.21000 |
| LogP | 4.25830 |
| Vapour Pressure | 6.62E-12mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | KDWXFOYQRQEDCC-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNc1c2ccccc2nc2c(Cl)ccc([N+](=O)[O-])c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(4-chloro-1-n... CAS#:116374-65-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 1 p. 23 - 30 |
|
~%
N-(4-chloro-1-n... CAS#:116374-65-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 1 p. 23 - 30 |
|
~%
N-(4-chloro-1-n... CAS#:116374-65-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 1 p. 23 - 30 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:13161-88-1This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: SMILES notation of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine is CN(C)CCCNc1c2ccccc2nc2c(Cl)ccc([N+](=O)[O-])c12. |
| Q: What are the upstream materials of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: Related upstream materials(CAS) of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine: 6283-25-6;1488-42-2;107210-28-6. |
| Q: What is the molecular formula of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: Molecular formula of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine is C18H19ClN4O2. |
| Q: What is the InChIKey of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: InChIKey of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine is KDWXFOYQRQEDCC-UHFFFAOYSA-N. |
| Q: What are the downstream products of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: Related downstream products(CAS) of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine: 13161-88-1. |
| Q: What is the CAS number of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: CAS number of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine is 116374-65-3. |
| Q: What is the polar surface area (PSA) of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: Polar surface area (PSA) of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine is 77.21000. |
| Q: What is the Chinese name of 116374-65-3? |
| A: Chinese name of 116374-65-3 is 116374-65-3. |
| Q: What is the boiling point of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: Boiling point of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine is 544.3ºC at 760 mmHg. |
| Q: What is the molecular weight of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine? |
| A: Molecular weight of N-(4-chloro-1-nitroacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine is 358.82200. |