4,9-Acridinediamine, N(sup 4),N(sup 4)-dimethyl-N(sup 9)-(3-(dimethyla mino)propyl)-1-nitro- structure
|
Common Name | 4,9-Acridinediamine, N(sup 4),N(sup 4)-dimethyl-N(sup 9)-(3-(dimethyla mino)propyl)-1-nitro- | ||
|---|---|---|---|---|
| CAS Number | 116374-67-5 | Molecular Weight | 367.44500 | |
| Density | 1.252g/cm3 | Boiling Point | 556.8ºC at 760mmHg | |
| Molecular Formula | C20H25N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.6ºC | |
| Name | 9-N-[3-(dimethylamino)propyl]-4-N,4-N-dimethyl-1-nitroacridine-4,9-diamine |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 556.8ºC at 760mmHg |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.44500 |
| Flash Point | 290.6ºC |
| Exact Mass | 367.20100 |
| PSA | 80.45000 |
| LogP | 3.67090 |
| Vapour Pressure | 1.96E-12mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | QPWBTZNSNJXXSU-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNc1c2ccccc2nc2c(N(C)C)ccc([N+](=O)[O-])c12 |
|
~%
4,9-Acridinedia... CAS#:116374-67-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 1 p. 23 - 30 |
|
~%
4,9-Acridinedia... CAS#:116374-67-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 1 p. 23 - 30 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |