9-(2-Diisopanoxyphosphonylmethoxyethyl)adenine structure
|
Common Name | 9-(2-Diisopanoxyphosphonylmethoxyethyl)adenine | ||
|---|---|---|---|---|
| CAS Number | 116384-53-3 | Molecular Weight | 329.292 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 531.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C12H20N5O4P | Melting Point | 136 °C | |
| MSDS | N/A | Flash Point | 275.0±32.9 °C | |
| Name | Diethyl ((2-(6-amino-9H-purin-9-yl)ethoxy)methyl)phosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.1±60.0 °C at 760 mmHg |
| Melting Point | 136 °C |
| Molecular Formula | C12H20N5O4P |
| Molecular Weight | 329.292 |
| Flash Point | 275.0±32.9 °C |
| Exact Mass | 329.125305 |
| PSA | 124.19000 |
| LogP | 0.25 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | SACBMARVYGBCAK-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(COCCn1cnc2c(N)ncnc21)OCC |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of human immunodeficiency virus type 1 (HIV-1) induced cytopathogenicity i...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL656772
|
|
Name: Inhibition of human immunodeficiency virus type 2 (HIV-2) induced cytopathogenicity i...
Source: ChEMBL
Target: Human immunodeficiency virus 2
External Id: CHEMBL656773
|
|
Name: Inhibitory activity against murine sarcoma virus induced transformation of murine C3H...
Source: ChEMBL
Target: N/A
External Id: CHEMBL651433
|
| 9-[2-(Diethoxyphosphorylmethoxy)ethyl]adenine |
| Phosphonic acid, P-[[2-(6-amino-9H-purin-9-yl)ethoxy]methyl]-, diethyl ester |
| Diethyl {[2-(6-amino-9H-purin-9-yl)ethoxy]methyl}phosphonate |
| Diethyl [[2-(6-Amino-9H-purin-9-yl)ethoxy]methyl]phosphonate |
| MFCD07783825 |
| [[2-(6-Amino-9H-purin-9-yl)ethoxy]methyl]phosphonic acid diethyl ester |
| 9-[2-(diethoxyphosphorylmethoxy)ethyl]purin-6-amine |
| Adefovir Impurity 7 |