(3-iodo-1-phenylprop-1-enoxy)-trimethylsilane
(3-iodo-1-phenylprop-1-enoxy)-trimethylsilane structure
|
Common Name | (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 116385-36-5 | Molecular Weight | 332.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17IOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (3-Iodo-1-phenylprop-1-enoxy)-trimethylsilane, CAS number: 116385-36-5, molecular formula: C12H17IOSi, molecular weight: 332.25300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17IOSi |
|---|---|
| Molecular Weight | 332.25300 |
| Exact Mass | 332.00900 |
| PSA | 9.23000 |
| LogP | 4.31400 |
| InChIKey | TXHWVFYUTZFWQD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=CCI)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(3-iodo-1-pheny... CAS#:116385-36-5 |
| Literature: Itoh, Keiji; Nakanishi, Saburo; Otsuji, Yoshio Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 10 p. 2965 - 2977 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:106696-59-7
CAS#:3375-38-0
CAS#:15447-62-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: SMILES notation of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is C[Si](C)(C)OC(=CCI)c1ccccc1. |
| Q: What are the downstream products of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: Related downstream products(CAS) of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane: 106696-59-7;3375-38-0;15447-62-8. |
| Q: What is the CAS number of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: CAS number of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is 116385-36-5. |
| Q: What is the molecular formula of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: Molecular formula of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is C12H17IOSi. |
| Q: What is the LogP of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: LogP of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is 4.31400. |
| Q: What is the polar surface area (PSA) of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: Polar surface area (PSA) of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is 9.23000. |
| Q: What is the molecular weight of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: Molecular weight of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is 332.25300. |
| Q: What is the InChIKey of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: InChIKey of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is TXHWVFYUTZFWQD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 116385-36-5? |
| A: Chinese name of 116385-36-5 is 116385-36-5. |
| Q: What is the English name of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane? |
| A: The English name of (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane is (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane. |