(3-iodo-1-phenylprop-1-enoxy)-trimethylsilane structure
|
Common Name | (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 116385-36-5 | Molecular Weight | 332.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17IOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-iodo-1-phenylprop-1-enoxy)-trimethylsilane |
|---|
| Molecular Formula | C12H17IOSi |
|---|---|
| Molecular Weight | 332.25300 |
| Exact Mass | 332.00900 |
| PSA | 9.23000 |
| LogP | 4.31400 |
| InChIKey | TXHWVFYUTZFWQD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=CCI)c1ccccc1 |
|
~%
(3-iodo-1-pheny... CAS#:116385-36-5 |
| Literature: Itoh, Keiji; Nakanishi, Saburo; Otsuji, Yoshio Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 10 p. 2965 - 2977 |