(3-iodocyclohexen-1-yl)oxy-trimethylsilane
(3-iodocyclohexen-1-yl)oxy-trimethylsilane structure
|
Common Name | (3-iodocyclohexen-1-yl)oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 116385-39-8 | Molecular Weight | 296.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17IOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (3-Iodo cyclohexen-1-yl)oxy-trimethylsilane, also known as C9H17IOSi, CAS number 116385-39-8, molecular formula C9H17IOSi, molecular weight 296.22100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-iodocyclohexen-1-yl)oxy-trimethylsilane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H17IOSi |
|---|---|
| Molecular Weight | 296.22100 |
| Exact Mass | 296.00900 |
| PSA | 9.23000 |
| LogP | 3.70930 |
| InChIKey | WNHNHHZTUWSOJO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=CC(I)CCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(3-iodocyclohex... CAS#:116385-39-8 |
| Literature: Itoh, Keiji; Nakanishi, Saburo; Otsuji, Yoshio Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 10 p. 2965 - 2977 Title/Abstract Full Text Show Details Ito, Keiji; Nakanishi, Saburo; Otsuji, Yoshio Chemistry Letters, 1987 , p. 2103 - 2106 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:62784-61-6This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: Related downstream products(CAS) of (3-iodocyclohexen-1-yl)oxy-trimethylsilane: 62784-61-6. |
| Q: What are the upstream materials of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: Related upstream materials(CAS) of (3-iodocyclohexen-1-yl)oxy-trimethylsilane: 930-68-7;16029-98-4. |
| Q: What is the InChIKey of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: InChIKey of (3-iodocyclohexen-1-yl)oxy-trimethylsilane is WNHNHHZTUWSOJO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: Molecular weight of (3-iodocyclohexen-1-yl)oxy-trimethylsilane is 296.22100. |
| Q: What is the Chinese name of 116385-39-8? |
| A: Chinese name of 116385-39-8 is 116385-39-8. |
| Q: What is the SMILES notation of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: SMILES notation of (3-iodocyclohexen-1-yl)oxy-trimethylsilane is C[Si](C)(C)OC1=CC(I)CCC1. |
| Q: What is the molecular formula of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: Molecular formula of (3-iodocyclohexen-1-yl)oxy-trimethylsilane is C9H17IOSi. |
| Q: What is the polar surface area (PSA) of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: Polar surface area (PSA) of (3-iodocyclohexen-1-yl)oxy-trimethylsilane is 9.23000. |
| Q: What is the LogP of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: LogP of (3-iodocyclohexen-1-yl)oxy-trimethylsilane is 3.70930. |
| Q: What is the English name of (3-iodocyclohexen-1-yl)oxy-trimethylsilane? |
| A: The English name of (3-iodocyclohexen-1-yl)oxy-trimethylsilane is (3-iodocyclohexen-1-yl)oxy-trimethylsilane. |