tert-Butyl 3-acetyl-4-oxopentanoate structure
|
Common Name | tert-Butyl 3-acetyl-4-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 116423-03-1 | Molecular Weight | 214.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-Butyl 3-acetyl-4-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H18O4 |
|---|---|
| Molecular Weight | 214.25800 |
| Exact Mass | 214.12100 |
| PSA | 60.44000 |
| LogP | 1.51240 |
| InChIKey | SNFYXMPXDXGOGA-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CC(=O)OC(C)(C)C)C(C)=O |
| HS Code | 2918300090 |
|---|
|
~63%
tert-Butyl 3-ac... CAS#:116423-03-1 |
| Literature: Tanaka, Masakazu; Imai, Masanori; Fujio, Masakazu; Sakamoto, Eishi; Takahashi, Miyuki; Eto-Kato, Yasuko; Wu, Xiao Ming; Funakoshi, Kazuhisa; Sakai, Kiyoshi; Suemune, Hiroshi Journal of Organic Chemistry, 2000 , vol. 65, # 18 p. 5806 - 5816 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,1-dimethylethyl 3-acetyl-4-oxopentanoate |
| tert-butyl-3-acetyl-4-oxopentanoate |