(4-Oxo-4-phenyl-butyl)-carbamic acid tert-butylester structure
|
Common Name | (4-Oxo-4-phenyl-butyl)-carbamic acid tert-butylester | ||
|---|---|---|---|---|
| CAS Number | 116437-41-3 | Molecular Weight | 263.33200 | |
| Density | 1.058g/cm3 | Boiling Point | 406.8ºC at 760mmHg | |
| Molecular Formula | C15H21NO3 | Melting Point | 90-91ºC | |
| MSDS | N/A | Flash Point | 199.8ºC | |
| Name | tert-Butyl (4-oxo-4-phenylbutyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 406.8ºC at 760mmHg |
| Melting Point | 90-91ºC |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33200 |
| Flash Point | 199.8ºC |
| Exact Mass | 263.15200 |
| PSA | 55.40000 |
| LogP | 3.56510 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | BAEFUAYRWLKGRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)c1ccccc1 |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|
|
~96%
(4-Oxo-4-phenyl... CAS#:116437-41-3 |
| Literature: WO2006/44825 A2, ; Page/Page column 55 ; WO 2006/044825 A2 |
|
~%
(4-Oxo-4-phenyl... CAS#:116437-41-3 |
| Literature: Journal of the American Chemical Society, , vol. 128, # 7 p. 2224 - 2225 |
|
~%
(4-Oxo-4-phenyl... CAS#:116437-41-3 |
| Literature: Journal of Organic Chemistry, , vol. 54, # 1 p. 228 - 234 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-butyl N-(4-oxo-4-phenylbutyl)carbamate |
| 2-Methyl-2-Propanyl (4-Oxo-4-Phenylbutyl)Carbamate |
| (4-Oxo-4-phenyl-butyl)-carbamic acid tert-butylester |