3,6-dipropoxybenzene-1,2-dicarbonitrile structure
|
Common Name | 3,6-dipropoxybenzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 116453-87-3 | Molecular Weight | 244.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dipropoxybenzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O2 |
|---|---|
| Molecular Weight | 244.28900 |
| Exact Mass | 244.12100 |
| PSA | 66.04000 |
| LogP | 3.00756 |
| InChIKey | YLIODFVRZQOKPF-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(OCCC)c(C#N)c1C#N |
|
~40%
3,6-dipropoxybe... CAS#:116453-87-3 |
| Literature: Cook, Michael J.; Dunn, Adrian J.; Howe, Steven D.; Thomson, Andrew J.; Harrison, Kenneth J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2453 - 2458 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2-Benzenedicarbonitrile,3,6-dipropoxy |
| 1,4-dipropoxy-2,3-dicyanobenzene |