3,6-dibutoxy-4,5-dichlorobenzene-1,2-dicarbonitrile structure
|
Common Name | 3,6-dibutoxy-4,5-dichlorobenzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 116453-92-0 | Molecular Weight | 341.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dibutoxy-4,5-dichlorobenzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18Cl2N2O2 |
|---|---|
| Molecular Weight | 341.23200 |
| Exact Mass | 340.07500 |
| PSA | 66.04000 |
| LogP | 5.09456 |
| InChIKey | QGIRKGNUERDNTB-UHFFFAOYSA-N |
| SMILES | CCCCOc1c(Cl)c(Cl)c(OCCCC)c(C#N)c1C#N |
|
~52%
3,6-dibutoxy-4,... CAS#:116453-92-0 |
| Literature: Cook, Michael J.; Dunn, Adrian J.; Howe, Steven D.; Thomson, Andrew J.; Harrison, Kenneth J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2453 - 2458 |
|
~%
3,6-dibutoxy-4,... CAS#:116453-92-0 |
| Literature: Van Haeringen; West; Davis; Gilbert; Hadley; Pearson; Wheldon; Henbest Photochemistry and Photobiology, 1998 , vol. 67, # 4 p. 407 - 413 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,2-Benzenedicarbonitrile,3,6-dibutoxy-4,5-dichloro |
| 1,4-DIBUTOXY-2,3-DICHLORO-5,6-DICYANOBENZENE |