N-[(4-fluorophenyl)methyl]-3-oxobutanamide structure
|
Common Name | N-[(4-fluorophenyl)methyl]-3-oxobutanamide | ||
|---|---|---|---|---|
| CAS Number | 116475-94-6 | Molecular Weight | 209.21700 | |
| Density | 1.168g/cm3 | Boiling Point | 404.5ºC at 760 mmHg | |
| Molecular Formula | C11H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | N-[(4-fluorophenyl)methyl]-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 404.5ºC at 760 mmHg |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.21700 |
| Flash Point | 198.5ºC |
| Exact Mass | 209.08500 |
| PSA | 46.17000 |
| LogP | 1.81190 |
| Vapour Pressure | 9.37E-07mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | KXWOJMGFAXNTEB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NCc1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ccg-5362 |