(2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline
Modify Date: 2026-06-21 20:07:23
![(2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline Structure](https://www.chemsrc.com/extcaspic/051/1165540-16-8.png)
(2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline structure
|
Common Name | (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline | ||
|---|---|---|---|---|
| CAS Number | 1165540-16-8 | Molecular Weight | 297.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15N3O3 |
|---|---|
| Molecular Weight | 297.31 |
| InChIKey | IQYLWHVFXDOCMW-NSHDSACASA-N |
| SMILES | CC1=NC2=C(C(=N1)N3CCC[C@H]3C(=O)O)OC4=CC=CC=C42 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: in vitro human biochemical cGAS inhibition from US Patent US20240189315: "Cyclic Pyri...
Source: BindingDB
Target: N/A
External Id: BindingDB_12218_1
|
|
Name: PKC-Theta and PKC-Delta Inhibition Assay from US Patent US12043625: "Pyridine derivat...
Source: BindingDB
Target: N/A
External Id: BindingDB_12199_1
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline? |
| A: Molecular formula of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline is C16H15N3O3. |
| Q: What is the molecular weight of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline? |
| A: Molecular weight of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline is 297.31. |
| Q: What is the InChIKey of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline? |
| A: InChIKey of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline is IQYLWHVFXDOCMW-NSHDSACASA-N. |
| Q: What is the English name of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline? |
| A: The English name of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline is (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline. |
| Q: What is the SMILES notation of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline? |
| A: SMILES notation of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline is CC1=NC2=C(C(=N1)N3CCC[C@H]3C(=O)O)OC4=CC=CC=C42. |
| Q: What is the Chinese name of 1165540-16-8? |
| A: Chinese name of 1165540-16-8 is 1165540-16-8. |
| Q: What is the CAS number of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline? |
| A: CAS number of (2-Methylbenzofuro[3,2-d]pyrimidin-4-yl)-L-proline is 1165540-16-8. |