1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole
Modify Date: 2025-11-07 12:52:53
1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole structure
|
Common Name | 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole | ||
|---|---|---|---|---|
| CAS Number | 116557-89-2 | Molecular Weight | 251.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13N3O |
|---|---|
| Molecular Weight | 251.28 |
| InChIKey | UJPIEACGBIJOKH-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2cc(-c3ccccc3)nn2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole? |
| A: Molecular formula of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole is C15H13N3O. |
| Q: What is the molecular weight of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole? |
| A: Molecular weight of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole is 251.28. |
| Q: What is the InChIKey of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole? |
| A: InChIKey of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole is UJPIEACGBIJOKH-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole? |
| A: The English name of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole is 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole. |
| Q: What is the SMILES notation of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole? |
| A: SMILES notation of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole is COc1ccc(-n2cc(-c3ccccc3)nn2)cc1. |
| Q: What is the CAS number of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole? |
| A: CAS number of 1-(4-Methoxyphenyl)-4-phenyl-1H-1,2,3-triazole is 116557-89-2. |
| Q: What is the Chinese name of 116557-89-2? |
| A: Chinese name of 116557-89-2 is 116557-89-2. |