3' 4'-DICHLOROBENZAMIL structure
|
Common Name | 3' 4'-DICHLOROBENZAMIL | ||
|---|---|---|---|---|
| CAS Number | 1166-01-4 | Molecular Weight | 388.64000 | |
| Density | 1.77 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12Cl3N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3′,4′-Dichlorobenzamil hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.77 g/cm3 |
|---|---|
| Molecular Formula | C13H12Cl3N7O |
| Molecular Weight | 388.64000 |
| Exact Mass | 387.01700 |
| PSA | 142.80000 |
| LogP | 4.09950 |
| Index of Refraction | 1.757 |
| InChIKey | OSHKWEFWXCCNJR-UHFFFAOYSA-N |
| SMILES | NC(=NCc1ccc(Cl)c(Cl)c1)NC(=O)c1nc(Cl)c(N)nc1N |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3' 4'-dichlorobenzamil |