N-Methylmonascamine
Modify Date: 2025-09-09 14:00:20
N-Methylmonascamine structure
|
Common Name | N-Methylmonascamine | ||
|---|---|---|---|---|
| CAS Number | 116606-70-3 | Molecular Weight | 395.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H29NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Methylmonascamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H29NO4 |
|---|---|
| Molecular Weight | 395.5 |
| InChIKey | QTDGJGISZGIFCA-KPZSNFNVSA-N |
| SMILES | CC=CC1=CC2=CC3=C(C(=O)CCCCCCC)C(=O)OC3(C)C(=O)C2=CN1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 116606-70-3? |
| A: Chinese name of 116606-70-3 is 116606-70-3. |
| Q: What is the CAS number of N-Methylmonascamine? |
| A: CAS number of N-Methylmonascamine is 116606-70-3. |
| Q: What is the molecular formula of N-Methylmonascamine? |
| A: Molecular formula of N-Methylmonascamine is C24H29NO4. |
| Q: What is the English name of N-Methylmonascamine? |
| A: The English name of N-Methylmonascamine is N-Methylmonascamine. |
| Q: What is the molecular weight of N-Methylmonascamine? |
| A: Molecular weight of N-Methylmonascamine is 395.5. |
| Q: What is the InChIKey of N-Methylmonascamine? |
| A: InChIKey of N-Methylmonascamine is QTDGJGISZGIFCA-KPZSNFNVSA-N. |
| Q: What is the SMILES notation of N-Methylmonascamine? |
| A: SMILES notation of N-Methylmonascamine is CC=CC1=CC2=CC3=C(C(=O)CCCCCCC)C(=O)OC3(C)C(=O)C2=CN1C. |