3-[3-[(α,α,α-Trifluoro-m-tolyl)oxy]propyl]-3-azaspiro[5.5]undecane structure
|
Common Name | 3-[3-[(α,α,α-Trifluoro-m-tolyl)oxy]propyl]-3-azaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 1167-20-0 | Molecular Weight | 355.43800 | |
| Density | 1.14g/cm3 | Boiling Point | 430.4ºC at 760 mmHg | |
| Molecular Formula | C20H28F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.1ºC | |
| Name | 3-[3-[3-(trifluoromethyl)phenoxy]propyl]-3-azaspiro[5.5]undecane |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 430.4ºC at 760 mmHg |
| Molecular Formula | C20H28F3NO |
| Molecular Weight | 355.43800 |
| Flash Point | 214.1ºC |
| Exact Mass | 355.21200 |
| PSA | 12.47000 |
| LogP | 5.45850 |
| Vapour Pressure | 1.3E-07mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | DJBUNNYSMQHCMK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(OCCCN2CCC3(CCCCC3)CC2)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |