2-(4-acetyl-3-hydroxyphenoxy)cyclohexan-1-one structure
|
Common Name | 2-(4-acetyl-3-hydroxyphenoxy)cyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 116719-54-1 | Molecular Weight | 248.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-acetyl-3-hydroxyphenoxy)cyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O4 |
|---|---|
| Molecular Weight | 248.27400 |
| Exact Mass | 248.10500 |
| PSA | 63.60000 |
| LogP | 2.48530 |
| InChIKey | IAEBHAAVXXYAAQ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OC2CCCCC2=O)cc1O |
|
~48%
2-(4-acetyl-3-h... CAS#:116719-54-1 |
| Literature: Soman, Shubhangi S. Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 3 p. 624 - 628 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-cyclohexan-2-onyloxy-2-hydroxyacetophenone |