1-(2-chloroethyl)-3-[(2R,3S,4R,6R)-3-hydroxy-6-methoxy-2-methyloxan-4-yl]-1-nitrosourea structure
|
Common Name | 1-(2-chloroethyl)-3-[(2R,3S,4R,6R)-3-hydroxy-6-methoxy-2-methyloxan-4-yl]-1-nitrosourea | ||
|---|---|---|---|---|
| CAS Number | 116724-61-9 | Molecular Weight | 295.72000 | |
| Density | 1.49g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H18ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-3-[(2R,3S,4R,6R)-3-hydroxy-6-methoxy-2-methyloxan-4-yl]-1-nitrosourea |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Molecular Formula | C10H18ClN3O5 |
| Molecular Weight | 295.72000 |
| Exact Mass | 295.09300 |
| PSA | 103.95000 |
| LogP | 0.63340 |
| Index of Refraction | 1.578 |
| InChIKey | VRHYBKAJHOTINF-FNCVBFRFSA-N |
| SMILES | COC1CC(NC(=O)N(CCCl)N=O)C(O)C(C)O1 |
|
~%
1-(2-chloroethy... CAS#:116724-61-9 |
| Literature: Roger; Monneret; Fournier; Choay; Gagnet; Gosse; Letourneux; Atassi; Gouyette Journal of Medicinal Chemistry, 1989 , vol. 32, # 1 p. 16 - 23 |
|
~%
1-(2-chloroethy... CAS#:116724-61-9 |
| Literature: Roger; Monneret; Fournier; Choay; Gagnet; Gosse; Letourneux; Atassi; Gouyette Journal of Medicinal Chemistry, 1989 , vol. 32, # 1 p. 16 - 23 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |