Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl
Modify Date: 2025-09-22 11:09:33
Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl structure
|
Common Name | Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl | ||
|---|---|---|---|---|
| CAS Number | 116752-57-9 | Molecular Weight | 461.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H19NO2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H19NO2S3 |
|---|---|
| Molecular Weight | 461.6 |
| InChIKey | YNKOECZJRARWMB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(c2ccc3c(c2)Sc2ccccc2S3)S(=O)(=O)c2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl? |
| A: InChIKey of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl is YNKOECZJRARWMB-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl? |
| A: Molecular weight of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl is 461.6. |
| Q: What is the SMILES notation of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl? |
| A: SMILES notation of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl is Cc1ccc(N(c2ccc3c(c2)Sc2ccccc2S3)S(=O)(=O)c2ccccc2)cc1. |
| Q: What is the English name of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl? |
| A: The English name of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl is Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl. |
| Q: What is the molecular formula of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl? |
| A: Molecular formula of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl is C25H19NO2S3. |
| Q: What is the CAS number of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl? |
| A: CAS number of Benzenesulfonamide, N-(4-methylphenyl)-N-2-thianthrenyl is 116752-57-9. |
| Q: What is the Chinese name of 116752-57-9? |
| A: Chinese name of 116752-57-9 is 116752-57-9. |