3-(3-Nitrophenoxy)-1-propanamine
Modify Date: 2025-09-26 07:44:53
3-(3-Nitrophenoxy)-1-propanamine structure
|
Common Name | 3-(3-Nitrophenoxy)-1-propanamine | ||
|---|---|---|---|---|
| CAS Number | 116753-51-6 | Molecular Weight | 196.203 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 354.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C9H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.9±22.3 °C | |
| Name | 3-(3-nitrophenoxy)propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.1±22.0 °C at 760 mmHg |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.203 |
| Flash Point | 167.9±22.3 °C |
| Exact Mass | 196.084793 |
| PSA | 81.07000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | QMRSDYBQUDEVCQ-UHFFFAOYSA-N |
| SMILES | NCCCOc1cccc([N+](=O)[O-])c1 |
| HS Code | 2922299090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(3-nitrophenoxy)propan-1-amine |
| 3-(3-Nitrophenoxy)-1-propanamine |