2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one
![2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one Structure](https://image.chemsrc.com/caspic/465/116805-49-3.png)
2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one structure
|
Common Name | 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 116805-49-3 | Molecular Weight | 235.30500 | |
| Density | 1.51g/cm3 | Boiling Point | 372.4ºC at 760 mmHg | |
| Molecular Formula | C11H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 372.4ºC at 760 mmHg |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.30500 |
| Flash Point | 179ºC |
| Exact Mass | 235.07800 |
| PSA | 75.50000 |
| LogP | 1.59220 |
| Vapour Pressure | 9.62E-06mmHg at 25°C |
| Index of Refraction | 1.763 |
| InChIKey | JHYUAMZGJCEADC-UHFFFAOYSA-N |
| SMILES | CCc1nn2c(=O)c3c(nc2s1)CCCC3 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~19%
2-ethyl-6,7,8,9... CAS#:116805-49-3 |
| Literature: Santagati, Andrea; Santagati, Maria; Russo, Fillippo; Ronsivalle, Giuseppe Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 949 - 953 |
|
~%
2-ethyl-6,7,8,9... CAS#:116805-49-3 |
| Literature: Santagati; Modica; Russo; Cutuli; Di Pietro; Amico-Roxas Pharmazie, 1994 , vol. 49, # 12 p. 880 - 884 |
![2-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]cyclohexene-1-carboxylic acid structure](https://image.chemsrc.com/caspic/439/160893-96-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-ethyl-6,7,8,9-tetrahydro-5H-1,3,4-thiadiazolo<2,3-b>quinazolin-5-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: Related downstream products(CAS) of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one: 160893-96-9. |
| Q: What is the Chinese name of 116805-49-3? |
| A: Chinese name of 116805-49-3 is 116805-49-3. |
| Q: What English synonyms does 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one have? |
| A: English synonyms of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one: 2-ethyl-6,7,8,9-tetrahydro-5H-1,3,4-thiadiazoloquinazolin-5-one. |
| Q: What is the boiling point of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: Boiling point of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one is 372.4ºC at 760 mmHg. |
| Q: What is the molecular formula of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: Molecular formula of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one is C11H13N3OS. |
| Q: What is the InChIKey of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: InChIKey of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one is JHYUAMZGJCEADC-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: Related upstream materials(CAS) of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one: 14068-53-2;1655-07-8;160893-96-9. |
| Q: What is the molecular weight of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: Molecular weight of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one is 235.30500. |
| Q: What is the English name of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: The English name of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one is 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one. |
| Q: What is the SMILES notation of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one? |
| A: SMILES notation of 2-ethyl-6,7,8,9-tetrahydro-[1,3,4]thiadiazolo[2,3-b]quinazolin-5-one is CCc1nn2c(=O)c3c(nc2s1)CCCC3. |