1-(2-Amino-1-(4-(benzyloxy)phenyl)ethyl)cyclohexanol structure
|
Common Name | 1-(2-Amino-1-(4-(benzyloxy)phenyl)ethyl)cyclohexanol | ||
|---|---|---|---|---|
| CAS Number | 1168135-16-7 | Molecular Weight | 325.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-Amino-1-(4-(benzyloxy)phenyl)ethyl)cyclohexanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H27NO2 |
|---|---|
| Molecular Weight | 325.44500 |
| Exact Mass | 325.20400 |
| PSA | 55.48000 |
| LogP | 4.70340 |
| InChIKey | VZCAQVAOYRJTED-UHFFFAOYSA-N |
| SMILES | NCC(c1ccc(OCc2ccccc2)cc1)C1(O)CCCCC1 |
| HS Code | 2922509090 |
|---|
|
~78%
1-(2-Amino-1-(4... CAS#:1168135-16-7 |
| Literature: MATRIX LABORATORIES LIMITED Patent: WO2009/84039 A2, 2009 ; Location in patent: Page/Page column 9 ; |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-[2-amino-1-(4-benzyloxyphenyl)ethyl]cyclohexanol |