(N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN
(N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN structure
|
Common Name | (N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN | ||
|---|---|---|---|---|
| CAS Number | 116858-79-8 | Molecular Weight | 418.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H41NOSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-di(propan-2-yl)-1-tributylstannylformamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H41NOSn |
|---|---|
| Molecular Weight | 418.23600 |
| Exact Mass | 419.22100 |
| PSA | 20.31000 |
| LogP | 6.65600 |
| InChIKey | ITBWSRXEUFZUTA-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(=O)N(C(C)C)C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~71%
(N,N-DIISOPROPY... CAS#:116858-79-8 |
| Literature: Lindsay, Charles M.; Widdowson, David A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 569 - 574 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN |
| tributyl-N,N-di-isoproylcarbamoylstannane |
| Stannanecarboxamide,1,1,1-tributyl-N,N-bis(1-methylethyl) |
| tributyl-N,N-di-isopropylcarbamoylstannane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: Polar surface area (PSA) of N,N-di(propan-2-yl)-1-tributylstannylformamide is 20.31000. |
| Q: What is the molecular formula of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: Molecular formula of N,N-di(propan-2-yl)-1-tributylstannylformamide is C19H41NOSn. |
| Q: What English synonyms does N,N-di(propan-2-yl)-1-tributylstannylformamide have? |
| A: English synonyms of N,N-di(propan-2-yl)-1-tributylstannylformamide: (N,N-DIISOPROPYLCARBAMOYL)TRIBUTYLTIN, tributyl-N,N-di-isoproylcarbamoylstannane, Stannanecarboxamide,1,1,1-tributyl-N,N-bis(1-methylethyl), tributyl-N,N-di-isopropylcarbamoylstannane. |
| Q: What is the CAS number of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: CAS number of N,N-di(propan-2-yl)-1-tributylstannylformamide is 116858-79-8. |
| Q: What is the LogP of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: LogP of N,N-di(propan-2-yl)-1-tributylstannylformamide is 6.65600. |
| Q: What is the English name of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: The English name of N,N-di(propan-2-yl)-1-tributylstannylformamide is N,N-di(propan-2-yl)-1-tributylstannylformamide. |
| Q: What is the molecular weight of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: Molecular weight of N,N-di(propan-2-yl)-1-tributylstannylformamide is 418.23600. |
| Q: What is the InChIKey of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: InChIKey of N,N-di(propan-2-yl)-1-tributylstannylformamide is ITBWSRXEUFZUTA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N,N-di(propan-2-yl)-1-tributylstannylformamide? |
| A: SMILES notation of N,N-di(propan-2-yl)-1-tributylstannylformamide is CCCC[Sn](CCCC)(CCCC)C(=O)N(C(C)C)C(C)C. |
| Q: What is the Chinese name of 116858-79-8? |
| A: Chinese name of 116858-79-8 is 116858-79-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |