N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine
Modify Date: 2025-09-28 16:36:59
![N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine Structure](https://www.chemsrc.com/extcaspic/240/116990-45-5.png)
N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine structure
|
Common Name | N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 116990-45-5 | Molecular Weight | 235.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17N3S |
|---|---|
| Molecular Weight | 235.35 |
| InChIKey | FRVIBFNUNBADRE-UHFFFAOYSA-N |
| SMILES | CC(C)N(c1nc2ccncc2s1)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine? |
| A: The English name of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine is N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine. |
| Q: What is the Chinese name of 116990-45-5? |
| A: Chinese name of 116990-45-5 is 116990-45-5. |
| Q: What is the CAS number of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine? |
| A: CAS number of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine is 116990-45-5. |
| Q: What is the SMILES notation of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine? |
| A: SMILES notation of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine is CC(C)N(c1nc2ccncc2s1)C(C)C. |
| Q: What is the molecular weight of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine? |
| A: Molecular weight of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine is 235.35. |
| Q: What is the InChIKey of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine? |
| A: InChIKey of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine is FRVIBFNUNBADRE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine? |
| A: Molecular formula of N,N-Bis(1-methylethyl)thiazolo[5,4-c]pyridin-2-amine is C12H17N3S. |