1-(2,7-dimethoxy-9H-fluoren-9-yl)pyrrolidine
Modify Date: 2025-09-09 19:25:39
1-(2,7-dimethoxy-9H-fluoren-9-yl)pyrrolidine structure
|
Common Name | 1-(2,7-dimethoxy-9H-fluoren-9-yl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 116997-65-0 | Molecular Weight | 295.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,7-dimethoxy-9H-fluoren-9-yl)pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H21NO2 |
|---|---|
| Molecular Weight | 295.37600 |
| Exact Mass | 295.15700 |
| PSA | 21.70000 |
| LogP | 3.80730 |
| InChIKey | ANWLHLAFLBQGJW-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(N1CCCC1)c1cc(OC)ccc1-2 |
|
~%
1-(2,7-dimethox... CAS#:116997-65-0 |
| Literature: Bordwell, F.G.; Cheng, Jin-Pei; Seyedrezai, S.E.; Wilson, Craig A. Journal of the American Chemical Society, 1988 , vol. 110, p. 8178 - 8183 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,7-dimethoxy-9-pyrrolidinylfluorene |