4-(2-Methoxyphenoxy)benzylamine hydrochloride, 2-[4-(Aminomethyl)phenoxy]anisole hydrochloride structure
|
Common Name | 4-(2-Methoxyphenoxy)benzylamine hydrochloride, 2-[4-(Aminomethyl)phenoxy]anisole hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1169974-82-6 | Molecular Weight | 265.73500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(2-methoxyphenoxy)phenyl]methanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16ClNO2 |
|---|---|
| Molecular Weight | 265.73500 |
| Exact Mass | 265.08700 |
| PSA | 44.48000 |
| LogP | 4.44850 |
| InChIKey | LGVPTQJKRPUICR-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Oc1ccc(CN)cc1.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4PBA-S01-1 |
| 4-(2-Methoxyphenoxy)benzylamine hydrochloride |
| AR1883 |