Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate
Modify Date: 2026-09-27 16:21:19
Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate structure
|
Common Name | Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 1169975-44-3 | Molecular Weight | 273.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19NO3 |
|---|---|
| Molecular Weight | 273.33 |
| InChIKey | YHLJBXHCFOSMGG-UHFFFAOYSA-N |
| SMILES | CCCc1nc(-c2ccccc2)oc1CC(=O)OCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate? |
| A: InChIKey of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate is YHLJBXHCFOSMGG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate? |
| A: Molecular weight of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate is 273.33. |
| Q: What is the CAS number of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate? |
| A: CAS number of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate is 1169975-44-3. |
| Q: What is the molecular formula of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate? |
| A: Molecular formula of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate is C16H19NO3. |
| Q: What is the SMILES notation of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate? |
| A: SMILES notation of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate is CCCc1nc(-c2ccccc2)oc1CC(=O)OCC. |
| Q: What is the Chinese name of 1169975-44-3? |
| A: Chinese name of 1169975-44-3 is 1169975-44-3. |
| Q: What is the English name of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate? |
| A: The English name of Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate is Ethyl (2-phenyl-4-propyl-1,3-oxazol-5-yl)acetate. |