1-chloro-4-[1-(4-chlorophenyl)-2-nitropropyl]benzene structure
|
Common Name | 1-chloro-4-[1-(4-chlorophenyl)-2-nitropropyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 117-27-1 | Molecular Weight | 310.17500 | |
| Density | 1.294g/cm3 | Boiling Point | 433.2ºC at 760mmHg | |
| Molecular Formula | C15H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.8ºC | |
| Name | 1-chloro-4-[1-(4-chlorophenyl)-2-nitropropyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 433.2ºC at 760mmHg |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.17500 |
| Flash Point | 215.8ºC |
| Exact Mass | 309.03200 |
| PSA | 45.82000 |
| LogP | 5.31370 |
| Vapour Pressure | 1.05E-07mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | JCWVUDIGEJLVPS-UHFFFAOYSA-N |
| SMILES | CC(C(c1ccc(Cl)cc1)c1ccc(Cl)cc1)[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| ENT 22,784 |
| 2-Nitro-1,1-bis-<p-chlor-phenyl>-propan |
| CS 645A |