2,7-Naphthalenedisulfonicacid, 4-(benzoylamino)-5-hydroxy- structure
|
Common Name | 2,7-Naphthalenedisulfonicacid, 4-(benzoylamino)-5-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 117-46-4 | Molecular Weight | 423.41700 | |
| Density | 1.718g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H13NO8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-benzamido-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.718g/cm3 |
|---|---|
| Molecular Formula | C17H13NO8S2 |
| Molecular Weight | 423.41700 |
| Exact Mass | 423.00800 |
| PSA | 174.83000 |
| LogP | 4.52570 |
| Index of Refraction | 1.742 |
| InChIKey | RKKZDGOUSIOSIY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 204-192-9 |
| 8-benzoylamino-3,6-disulfo-1-naphthol |
| 1-benzoylamino-8-naphthol-3,6-disulfonic acid |
| 4-benzoylamino-5-hydroxy-naphthalene-2,7-disulfonic acid |
| 1-hydroxy-8-benzoylamino-naphthalene-3,6-disulphonic acid |
| H Acid,N-benzoyl |
| N-Benzoyl H-acid |
| 4-Benzoylamino-5-hydroxy-naphthalin-2,7-disulfonsaeure |