8-hydroxy-7-[(4-sulpho-1-naphthyl)azo]quinoline-5-sulphonic acid
Modify Date: 2025-09-11 19:43:24
![8-hydroxy-7-[(4-sulpho-1-naphthyl)azo]quinoline-5-sulphonic acid Structure](https://image.chemsrc.com/caspic/251/117-87-3.png)
8-hydroxy-7-[(4-sulpho-1-naphthyl)azo]quinoline-5-sulphonic acid structure
|
Common Name | 8-hydroxy-7-[(4-sulpho-1-naphthyl)azo]quinoline-5-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 117-87-3 | Molecular Weight | 459.45200 | |
| Density | 1.69g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H13N3O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Hydroxy-7-((4-sulfo-1-naphthyl)azo)quinoline-5-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.69g/cm3 |
|---|---|
| Molecular Formula | C19H13N3O7S2 |
| Molecular Weight | 459.45200 |
| Exact Mass | 459.01900 |
| PSA | 183.34000 |
| LogP | 6.16400 |
| Index of Refraction | 1.758 |
| InChIKey | GNOVKNAMSGDHAT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(N=Nc2cc(S(=O)(=O)O)c3cccnc3c2O)c2ccccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 204-217-3 |