[(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride structure
|
Common Name | [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride | ||
|---|---|---|---|---|
| CAS Number | 1170072-56-6 | Molecular Weight | 576.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H26Cl2SiZr | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H26Cl2SiZr |
|---|---|
| Molecular Weight | 576.7 |
| InChIKey | ZKJZTMGEWTVAIA-UHFFFAOYSA-L |
| SMILES | CC[Si](CC)([c-]1c2ccccc2c2ccccc21)[c-]1c2ccccc2c2ccccc21.Cl[Zr+2]Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride? |
| A: InChIKey of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride is ZKJZTMGEWTVAIA-UHFFFAOYSA-L. |
| Q: What is the SMILES notation of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride? |
| A: SMILES notation of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride is CC[Si](CC)([c-]1c2ccccc2c2ccccc21)[c-]1c2ccccc2c2ccccc21.Cl[Zr+2]Cl. |
| Q: What is the English name of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride? |
| A: The English name of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride is [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride. |
| Q: What is the molecular weight of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride? |
| A: Molecular weight of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride is 576.7. |
| Q: What is the molecular formula of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride? |
| A: Molecular formula of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride is C30H26Cl2SiZr. |
| Q: What is the Chinese name of 1170072-56-6? |
| A: Chinese name of 1170072-56-6 is 1170072-56-6. |
| Q: What is the CAS number of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride? |
| A: CAS number of [(Diethylsilylene)-bis(fluoren-9-yl)]zirconium(IV) dichloride is 1170072-56-6. |