Cyclohexanone, 2,6-bis[3-(2-methoxyphenyl)-2-propenylidene]-4-methyl- structure
|
Common Name | Cyclohexanone, 2,6-bis[3-(2-methoxyphenyl)-2-propenylidene]-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 117069-09-7 | Molecular Weight | 400.50900 | |
| Density | 1.167g/cm3 | Boiling Point | 598.2ºC at 760mmHg | |
| Molecular Formula | C27H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.6ºC | |
| Name | Cyclohexanone, 2,6-bis[3-(2-methoxyphenyl)-2-propenylidene]-4-methyl |
|---|
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 598.2ºC at 760mmHg |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.50900 |
| Flash Point | 308.6ºC |
| Exact Mass | 400.20400 |
| PSA | 35.53000 |
| LogP | 6.28220 |
| Vapour Pressure | 2.85E-14mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | KFKWEFLYSAEENV-GDJDMGBCSA-N |
| SMILES | COc1ccccc1C=CC=C1CC(C)CC(=CC=Cc2ccccc2OC)C1=O |
|
~%
Cyclohexanone, ... CAS#:117069-09-7 |
| Literature: Al-Arab, Mohammad M.; Abu-Yousef, Imad A. Journal of Chemical & Engineering Data, 1989 , vol. 34, # 1 p. 137 - 139 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |